4-Trimethylsilanylaniline manufacturers
|
| | 4-Trimethylsilanylaniline Basic information |
| Product Name: | 4-Trimethylsilanylaniline | | Synonyms: | 4-Trimethylsilanylaniline;4-AMinophenyl-triMethylsilane;4-(trimethylsilyl)benzenamine;4-trimethylsilylaniline;Benzenamine, 4-(trimethylsilyl)- | | CAS: | 17889-23-5 | | MF: | C9H15NSi | | MW: | 165.31 | | EINECS: | | | Product Categories: | | | Mol File: | 17889-23-5.mol |  |
| | 4-Trimethylsilanylaniline Chemical Properties |
| Boiling point | 113 °C(Press: 10 Torr) | | density | 0.947 g/cm3 | | storage temp. | 2-8°C, protect from light | | pka | 4.16±0.10(Predicted) | | Appearance | Colorless to off-white Solid | | InChI | InChI=1S/C9H15NSi/c1-11(2,3)9-6-4-8(10)5-7-9/h4-7H,10H2,1-3H3 | | InChIKey | XZBZOTJKKCXYPA-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C([Si](C)(C)C)C=C1 |
| | 4-Trimethylsilanylaniline Usage And Synthesis |
| | 4-Trimethylsilanylaniline Preparation Products And Raw materials |
|