|
|
| | 4,4'-Diiodo-2,2'-dimethylbiphenyl Basic information |
| Product Name: | 4,4'-Diiodo-2,2'-dimethylbiphenyl | | Synonyms: | 4-iodo-1-(4-iodo-2-methylphenyl)-2-methylbenzene;1,1'-Biphenyl,4,4'-diiodo-2,2'-dimethyl-;4,4'-Diiodo-2,2'-dimethyl-1,1'-biphenyl;4,4'-Diiodo-2,2'-dimethylbiphenyl;2,2'-diMethyl-4,4'-diodobiphenyl;2,2'-dimethyl-4,4'-diiodo-1,1'-biphenyl;4,4'-Diiodo-2,2'-dimethylbiphenyl >;4,4'-Diiodo-2,2'-dimethyL | | CAS: | 69571-02-4 | | MF: | C14H12I2 | | MW: | 434.05 | | EINECS: | 804-250-9 | | Product Categories: | OLED | | Mol File: | 69571-02-4.mol |  |
| | 4,4'-Diiodo-2,2'-dimethylbiphenyl Chemical Properties |
| Melting point | 96.0 to 100.0 °C | | Boiling point | 374.8±42.0 °C(Predicted) | | density | 1.875 | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Toluene | | form | powder to crystal | | color | White to Almost white | | InChI | 1S/C14H12I2/c1-9-7-11(15)3-5-13(9)14-6-4-12(16)8-10(14)2/h3-8H,1-2H3 | | InChIKey | WHFMNDMHTIOIMS-UHFFFAOYSA-N | | SMILES | Cc1cc(I)ccc1-c2ccc(I)cc2C |
| Hazard Codes | Xi,N | | Risk Statements | 41-50/53 | | Safety Statements | 26-39-60-61 | | RIDADR | UN 3152PSN1 9 / PGII | | WGK Germany | 3 | | HS Code | 2903.99.8001 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Eye Dam. 1 |
| | 4,4'-Diiodo-2,2'-dimethylbiphenyl Usage And Synthesis |
| | 4,4'-Diiodo-2,2'-dimethylbiphenyl Preparation Products And Raw materials |
|