|
|
| | 4,6-DIMETHYLDIBENZOTHIOPHENE Basic information |
| Product Name: | 4,6-DIMETHYLDIBENZOTHIOPHENE | | Synonyms: | 4,6-DMDBT;4,6-DIMETHYLDIBENZOTHIOPHENE;4,6-diMethyldibenzo[b,d]thiophene;6-DMDBT;4,6-dimethyl-dibenzothiophen;Dibenzothiophene, 4,6-dimethyl-;4,6-Dimethyldibenzothiophene ,97%;4,6-Dimethyldibenzothiophene, 97%, for synthesis | | CAS: | 1207-12-1 | | MF: | C14H12S | | MW: | 212.31 | | EINECS: | 214-894-7 | | Product Categories: | API intermediates;Benzothiophenes;Building Blocks;Heterocyclic Building Blocks | | Mol File: | 1207-12-1.mol |  |
| | 4,6-DIMETHYLDIBENZOTHIOPHENE Chemical Properties |
| Melting point | 153-157 °C (lit.) | | Boiling point | 312.16°C (rough estimate) | | density | 1.1405 (rough estimate) | | refractive index | 1.6170 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Crystalline Powder or Crystals | | color | White to beige | | InChI | InChI=1S/C14H12S/c1-9-5-3-7-11-12-8-4-6-10(2)14(12)15-13(9)11/h3-8H,1-2H3 | | InChIKey | MYAQZIAVOLKEGW-UHFFFAOYSA-N | | SMILES | C12=C(C)C=CC=C1C1=CC=CC(C)=C1S2 | | EPA Substance Registry System | Dibenzothiophene, 4,6-dimethyl- (1207-12-1) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | 4,6-DIMETHYLDIBENZOTHIOPHENE Usage And Synthesis |
| Chemical Properties | light yellow to light brown crystalline solid | | Uses | 4,6-Dimethyldibenzothiophene is used in petroleum desulfurization studies. | | General Description | 4,6-Dimethyldibenzothiophene (4,6-DMDBT), a high refractory sulfur compound, is commonly found in diesel fuel. Its synthesis has been reported. The hydrodesulfurization of 4,6-DMDBT using bulk nickel alloy, bulk tungsten phosphide (WP), NiMo sulfide supported on active carbons and molecularly imprinted polymers have been reported. The dielectric behavior of 4,6-DMDBT under different microwave frequencies and temperature has been investigated. |
| | 4,6-DIMETHYLDIBENZOTHIOPHENE Preparation Products And Raw materials |
|