2-Bromo-4-fluoro-5-methoxyaniline manufacturers
|
| | 2-Bromo-4-fluoro-5-methoxyaniline Basic information |
| Product Name: | 2-Bromo-4-fluoro-5-methoxyaniline | | Synonyms: | 2-Bromo-4-fluoro-5-methoxyaniline;2-Bromo-4-fluoro-5-(methyloxy)aniline;6-Bromo-4-fluoro-3-methoxyaniline;2-Bromo-4-fluoro-5-methoxy-phenylamine;Benzenamine, 2-bromo-4-fluoro-5-methoxy-;2-Bromo-4-fluoro-5-methoxyaniline ISO 9001：2015 REACH | | CAS: | 420786-92-1 | | MF: | C7H7BrFNO | | MW: | 220.04 | | EINECS: | | | Product Categories: | | | Mol File: | 420786-92-1.mol |  |
| | 2-Bromo-4-fluoro-5-methoxyaniline Chemical Properties |
| Boiling point | 290.6±35.0℃ (760 Torr) | | density | 1.616±0.06 g/cm3 (20 ºC 760 Torr) | | Fp | 129.6±25.9℃ | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | Appearance | Light brown to khaki Solid | | InChI | InChI=1S/C7H7BrFNO/c1-11-7-3-6(10)4(8)2-5(7)9/h2-3H,10H2,1H3 | | InChIKey | JRWKTSZPTRTXFS-UHFFFAOYSA-N | | SMILES | C1(N)=CC(OC)=C(F)C=C1Br |
| | 2-Bromo-4-fluoro-5-methoxyaniline Usage And Synthesis |
| | 2-Bromo-4-fluoro-5-methoxyaniline Preparation Products And Raw materials |
|