| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2-N-Methyl-2-pyridylaminoethanol Basic information |
| Product Name: | 2-N-Methyl-2-pyridylaminoethanol | | Synonyms: | N-METHYL-N-(2-PYRIDYL)ETHANOLAMINE;2-[N-(2-HYDROXYETHYL)-N-METHYLAMINO]PYRIDINE;2-[(N-METHYL-N-2-PYRIDINYL) AMINO]ETHANOL;2-(N-METHYL-2-PYRIDYLAMINO)ETHANOL;2-[METHYL(2-PYRIDINYL)AMINO]-1-ETHANOL;2-(METHYL-2-PYRIDINYLAMINO)-ETHANOL;2-(METHYL-2-PYRIDYLAMINO)ETHANOL;IFLAB-BB F2108-0001 | | CAS: | 122321-04-4 | | MF: | C8H12N2O | | MW: | 152.19 | | EINECS: | 602-493-3 | | Product Categories: | XHL | | Mol File: | 122321-04-4.mol |  |
| | 2-N-Methyl-2-pyridylaminoethanol Chemical Properties |
| Boiling point | 98-100°C 0,1mm | | density | 1.12 | | refractive index | 1.5705-1.5735 | | storage temp. | Sealed in dry,Room Temperature | | pka | 14.59±0.10(Predicted) | | form | clear liquid | | color | Colorless to Light orange to Yellow | | Water Solubility | Soluble in water. | | InChI | InChI=1S/C8H12N2O/c1-10(6-7-11)8-4-2-3-5-9-8/h2-5,11H,6-7H2,1H3 | | InChIKey | MWGKOPUDDQZERY-UHFFFAOYSA-N | | SMILES | C(O)CN(C)C1=NC=CC=C1 | | CAS DataBase Reference | 122321-04-4(CAS DataBase Reference) |
| | 2-N-Methyl-2-pyridylaminoethanol Usage And Synthesis |
| Chemical Properties | clear light yellow to light brown viscous liquid | | Uses | 2-Methyl-2-pyridylaminoethanol is used as a reagent to synthesize Rosiglitazone (Maleate: R693500), a thiazolinedione drug used to reduce insulin resistance in patients with Type 2 diabetes. |
| | 2-N-Methyl-2-pyridylaminoethanol Preparation Products And Raw materials |
|