- 4-Methoxyphenethylamine
-
- $0.00 / 25KG
-
2025-08-08
- CAS:55-81-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 50000KG/month
|
| | 4-Methoxyphenethylamine Basic information |
| Product Name: | 4-Methoxyphenethylamine | | Synonyms: | 2-(4-Methoxyphenyl)ethanamine;4-Methoxy-2-phenethylamine;4-methoxy-benzeneethanamin;4-Methoxybenzeneethanamine;4-Methoxy-beta-phenylethylamine;Homoanisylamine;2-(4-Methoxyphenyl)ethylamine 97%;PARA-METHOXYPHENYLETHYLAMINE | | CAS: | 55-81-2 | | MF: | C9H13NO | | MW: | 151.21 | | EINECS: | 200-245-5 | | Product Categories: | | | Mol File: | 55-81-2.mol |  |
| | 4-Methoxyphenethylamine Chemical Properties |
| Melting point | 249-251°C | | Boiling point | 138-140 °C20 mm Hg(lit.) | | density | 1.031 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.538(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | pka | 9.96±0.10(Predicted) | | form | liquid | | color | light yellow | | BRN | 508967 | | InChI | InChI=1S/C9H13NO/c1-11-9-4-2-8(3-5-9)6-7-10/h2-5H,6-7,10H2,1H3 | | InChIKey | LTPVSOCPYWDIFU-UHFFFAOYSA-N | | SMILES | C1(CCN)=CC=C(OC)C=C1 | | CAS DataBase Reference | 55-81-2(CAS DataBase Reference) | | NIST Chemistry Reference | Benzeneethanamine, 4-methoxy-(55-81-2) | | EPA Substance Registry System | Benzeneethanamine, 4-methoxy- (55-81-2) |
| Hazard Codes | C,T | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45-27 | | RIDADR | UN 2735 8/PG 3 | | WGK Germany | 3 | | RTECS | SH7875000 | | F | 10-23 | | Hazard Note | Toxic/Corrosive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29222900 |
| | 4-Methoxyphenethylamine Usage And Synthesis |
| Chemical Properties | clear colorless to slightly yellow liquid | | Uses | 4-Methoxyphenethylamine an inhibitor of the deamination of tyramine and tryptamine. It is intermediates of ritodrine. ritodrine is an adrenergic β2 receptor agonists used to prevent premature birth. | | Application | 4-Methoxyphenethylamine was used in the synthesis of :
pyrrolo[3,2-c]carbazole
poly(4-methoxyphenethylamine), required for the immobilization of nitrogenated bases and oligonucleotides
organopolyphosphazenes such as poly[bis(4-methoxy benzylamino)polyphosphazene] and poly[bis(4-methoxyphenethylamino)polyphosphazene]
4-methoxyphenethylamine was reacted with CDI and obtained N-substituted imidazolide intermediate. | | Definition | ChEBI: 4-methoxyphenylethylamine is a primary amino compound consisting of ethylamine having a 4-methoxyphenyl substituent at the 2-position. It derives from a hydride of a 2-phenylethylamine. | | Synthesis Reference(s) | Journal of Medicinal Chemistry, 15, p. 214, 1972 DOI: 10.1021/jm00272a029 | | General Description | 4-Methoxyphenethylamine inhibits the monoamine oxidase-catalyzed deamination of both tyramine and tryptamine. |
| | 4-Methoxyphenethylamine Preparation Products And Raw materials |
|