|
|
| | ETHYL 4-CHLOROBUTYRATE Basic information |
| | ETHYL 4-CHLOROBUTYRATE Chemical Properties |
| Boiling point | 186 °C(lit.) | | density | 1.075 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.432(lit.) | | Fp | 125 °F | | storage temp. | Flammables area | | form | Liquid | | color | Clear yellow to brownish | | Water Solubility | Insoluble | | BRN | 1098810 | | InChI | InChI=1S/C6H11ClO2/c1-2-9-6(8)4-3-5-7/h2-5H2,1H3 | | InChIKey | OPXNFHAILOHHFO-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)CCCCl | | CAS DataBase Reference | 3153-36-4(CAS DataBase Reference) | | NIST Chemistry Reference | Butanoic acid, 4-chloro-, ethyl ester(3153-36-4) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22-10 | | Safety Statements | 26-36-37/39-16-24/25 | | RIDADR | 1993 | | WGK Germany | 3 | | F | 21 | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29159000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | ETHYL 4-CHLOROBUTYRATE Usage And Synthesis |
| Chemical Properties | clear yellow to brownish liquid | | Uses | Ethyl 4-chlorobutyrate is a reagent used in the preparation of cyclopropane derivatives. | | Uses | Ethyl 4-chlorobutyrate is used in organic synthesis. And also used for producting 4-Iodo-butyric acid ethyl ester. | | Synthesis Reference(s) | Synthesis, p. 538, 1973 DOI: 10.1055/s-1973-22254 |
| | ETHYL 4-CHLOROBUTYRATE Preparation Products And Raw materials |
| Preparation Products | 1(2H)-Pyrimidinebutanoic acid, 5-ethyltetrahydro-2,4,6-trioxo-5-phenyl-, ethyl ester-->1,3-Dioxolane, 2-(3-chloropropyl)-2-ethoxy--->AKOS BBS-00007386-->5,6,7,8-TETRAHYDRO-IMIDAZO[1,2-A]PYRIDINE-6-CARBOXYLIC ACID ETHYL ESTER |
|