| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:1,3-Dichloro-2-propanol-d5
CAS:1173020-20-6
Package:100Mg,10Mg
|
| Company Name: |
Shanghai Aladdin Bio-Chem Technology Co.,LTD
|
| Tel: |
400-6206333 13167063860 |
| Email: |
anhua.mao@aladdin-e.com |
| Products Intro: |
Product Name:1,3-Dichloro-2-propanol-d5
CAS:1173020-20-6
Purity:98 atom % D,97%（CP） Package:10mg/RMB 1029.90;50mg/RMB 2779.90;250mg/RMB 8341.90
|
|
| | 1,3-DICHLORO-ISO-PROPYL-D5 ALCOHOL Basic information |
| Product Name: | 1,3-DICHLORO-ISO-PROPYL-D5 ALCOHOL | | Synonyms: | 1,3-DICHLORO-ISO-PROPYL-D5 ALCOHOL;1,3-dichloro-1,1,2,3,3-pentadeuteriopropan-2-ol;[2H5]-1,3-Dichloro-2-propanol;1,3-DICHLORO-2-PROPANOL (D5, 98%) 1 MG/ML IN METHANOL;1,3-Dichloro-2-propanol-d5 in methanol;1,3-Dichloroisopropyl-d5 alcohol;1,3-Dichloropropan-2-ol D5;1,3-Dichloro-2-propanol (D?, 98%) 1 mg/mL in methanol | | CAS: | 1173020-20-6 | | MF: | C3H6Cl2O | | MW: | 128.98 | | EINECS: | | | Product Categories: | Aliphatics, Isotope Labelled Compounds, Mutagenesis Research Chemicals | | Mol File: | Mol File |  |
| | 1,3-DICHLORO-ISO-PROPYL-D5 ALCOHOL Chemical Properties |
| Melting point | -4 °C(lit.) | | Boiling point | 174.3 °C(lit.) | | density | 1.417 g/mL at 25 °C | | Fp | 85 °C | | solubility | Chloroform (Slightly), Methanol (Slightly), Water | | form | Oil | | color | Colourless | | InChI | 1S/C3H6Cl2O/c4-1-3(6)2-5/h3,6H,1-2H2/i1D2,2D2,3D | | InChIKey | DEWLEGDTCGBNGU-UXXIZXEISA-N | | SMILES | [2H]C([2H])(Cl)C([2H])(O)C([2H])([2H])Cl | | CAS Number Unlabeled | 96-23-1 |
| Hazard Codes | T | | Risk Statements | 45-21-25 | | Safety Statements | 53-45 | | RIDADR | UN 2750 6.1/PG 2 | | WGK Germany | WGK 3 | | HS Code | 28459000 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Oral
Acute Tox. 4 Dermal
Carc. 1B |
| | 1,3-DICHLORO-ISO-PROPYL-D5 ALCOHOL Usage And Synthesis |
| Chemical Properties | Clear Colorless Oil | | Uses | A labelled chloropropanol which shows toxic effects. |
| | 1,3-DICHLORO-ISO-PROPYL-D5 ALCOHOL Preparation Products And Raw materials |
|