N-Acetyl-L-serine manufacturers
|
| | N-Acetyl-L-serine Basic information |
| Product Name: | N-Acetyl-L-serine | | Synonyms: | N-Acetyl-L-serine;(2S)-2-acetamido-3-hydroxy-propanoic acid;L-Serine, N-acetyl-;(S)-2-AcetaMido-3-hydroxypropanoic acid;N-Ac-L-Ser-OH;N-α-Acetyl-L-serine;N-Acetylserine | | CAS: | 16354-58-8 | | MF: | C5H9NO4 | | MW: | 147.13 | | EINECS: | | | Product Categories: | | | Mol File: | 16354-58-8.mol |  |
| | N-Acetyl-L-serine Chemical Properties |
| Melting point | 207.6℃ | | Boiling point | 468.4±40.0 °C(Predicted) | | density | 1.343±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly, Sonicated), Methanol (Sparingly), Water (Sparingly) | | pka | 3.27±0.10(Predicted) | | form | Solid | | color | Off-White to Beige | | Stability: | Hygroscopic | | InChI | InChI=1S/C5H9NO4/c1-3(8)6-4(2-7)5(9)10/h4,7H,2H2,1H3,(H,6,8)(H,9,10)/t4-/m0/s1 | | InChIKey | JJIHLJJYMXLCOY-BYPYZUCNSA-N | | SMILES | C(O)(=O)[C@H](CO)NC(C)=O |
| | N-Acetyl-L-serine Usage And Synthesis |
| Uses | N-Acetyl-L-serine (cas# 16354-58-8) was useful for studying wheat drought tolerance. | | Definition | ChEBI: An N-acetyl-L-amino acid in which the amino acid specified is L-serine. Metabolite observed in cancer metabolism. | | IC 50 | Human Endogenous Metabolite |
| | N-Acetyl-L-serine Preparation Products And Raw materials |
|