|
|
| | Nickel(II) Trifluoromethanesulfonate Basic information |
| | Nickel(II) Trifluoromethanesulfonate Chemical Properties |
| Melting point | 100-106 °C | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder | | color | pale green | | Water Solubility | Partly soluble in water. | | Sensitive | Hygroscopic | | Exposure limits | NIOSH: IDLH 10 mg/m3; TWA 0.015 mg/m3 | | Stability: | hygroscopic | | InChI | InChI=1S/CHF3O3S.Ni/c2-1(3,4)8(5,6)7;/h(H,5,6,7); | | InChIKey | PDXOPNHXAAQJJO-UHFFFAOYSA-N | | SMILES | C(F)(F)(F)S(O)(=O)=O.[Ni] |
| Hazard Codes | C,Xi | | Risk Statements | 45-36/37/38-43 | | Safety Statements | 36/37/39 | | RIDADR | UN 1759 8/PG III | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2905190098 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Carc. 1A Inhalation
Eye Irrit. 2
Muta. 2
Repr. 1B
Resp. Sens. 1
Skin Irrit. 2
Skin Sens. 1
STOT RE 1 |
| | Nickel(II) Trifluoromethanesulfonate Usage And Synthesis |
| Uses | It is used as a pharmaceutical intermediate and as OLED chemicals. | | reaction suitability | core: nickel
reagent type: catalyst |
| | Nickel(II) Trifluoromethanesulfonate Preparation Products And Raw materials |
|