|
|
| | 5-Bromo-2-hydroxyacetophenone Basic information |
| | 5-Bromo-2-hydroxyacetophenone Chemical Properties |
| Melting point | 58-61 °C(lit.) | | Boiling point | 135-143 °C(Press: 16 Torr) | | density | 1.586±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in Chloroform | | pka | 9.59±0.18(Predicted) | | form | Solid | | color | White to pale yellow | | InChI | InChI=1S/C8H7BrO2/c1-5(10)7-4-6(9)2-3-8(7)11/h2-4,11H,1H3 | | InChIKey | HQCCNFFIOWYINW-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC(Br)=CC=C1O)C | | LogP | 3.110 (est) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | KM5556350 | | HazardClass | IRRITANT | | HS Code | 29147000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 | | Toxicity | mouse,LD50,intraperitoneal,> 1gm/kg (1000mg/kg),Indian Journal of Chemistry, Section B: Organic Chemistry, Including Medicinal Chemistry. Vol. 20, Pg. 480, 1981. |
| | 5-Bromo-2-hydroxyacetophenone Usage And Synthesis |
| Chemical Properties | White to pale yellow crystalline powder | | Uses | 5-Bromo-2-hydroxyacetophenone (5-Bromo-2-hydroxyacetophenone) may be used in ligand in the preparation of tetrahedral metallocene complexes containing vanadium(IV), synthesis of {2-[1-(5-bromo-2-oxidophenyl) ethylidene] benzohydrazidato (2-)} tris(pyridine) nickel(II)] pyridine solvate, synthesis of N-[1-(5-bromo-2-hydroxyphenyl)ethylidene]-3,4,5-trihydroxybenzohydrazide dimethyl sulfoxide solvate trihydrate, preparation of 6-bromochromen-4-one. | | Preparation | Preparation by Fries rearrangement of 4-bromophenyl acetate with aluminium chloride without solvent between 110° and 160° (84–91%). |
| | 5-Bromo-2-hydroxyacetophenone Preparation Products And Raw materials |
|