3,4-DIMETHOXYCINNAMIC ACID manufacturers
|
| | 3,4-DIMETHOXYCINNAMIC ACID Basic information |
| Product Name: | 3,4-DIMETHOXYCINNAMIC ACID | | Synonyms: | OTAVA-BB BB0107620014;RARECHEM BK HC T253;AKOS BB/0042;AKOS BBS-00000090;(E)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid;3-(3,4-DIMETHOXY-PHENYL)-ACRYLIC ACID;3-(3,4-DIMETHOXYPHENYL)-2-PROPENOIC ACID;(2E)-3-(3,4-DIMETHOXYPHENYL)ACRYLIC ACID | | CAS: | 14737-89-4 | | MF: | C11H12O4 | | MW: | 208.21 | | EINECS: | 238-801-4 | | Product Categories: | Others chemical reagents | | Mol File: | 14737-89-4.mol |  |
| | 3,4-DIMETHOXYCINNAMIC ACID Chemical Properties |
| Melting point | 181-183 °C(lit.) | | Boiling point | 367.4±27.0 °C(Predicted) | | density | 1.203 | | storage temp. | Sealed in dry,Room Temperature | | form | powder | | pka | 4.53±0.10(Predicted) | | color | White | | InChI | InChI=1S/C11H12O4/c1-14-9-5-3-8(4-6-11(12)13)7-10(9)15-2/h3-7H,1-2H3,(H,12,13)/b6-4+ | | InChIKey | HJBWJAPEBGSQPR-GQCTYLIASA-N | | SMILES | C(O)(=O)/C=C/C1=CC=C(OC)C(OC)=C1 | | CAS DataBase Reference | 14737-89-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | WGK Germany | 3 | | HS Code | 2918999090 |
| | 3,4-DIMETHOXYCINNAMIC ACID Usage And Synthesis |
| Uses | (E)-3,4-Dimethoxycinnamic acid is the less active isomer of 3,4-Dimethoxycinnamic acid. 3,4-Dimethoxycinnamic acid exerts anti-apoptotic effects on L-02 cells via the ROS-mediated signaling pathway[1]. Anti-apoptotic effects[1]. | | Definition | ChEBI: A methoxycinnamic acid that is trans-cinnamic acid substituted by methoxy groups at positions 3' and 4' respectively. | | References | [1] Li L, et al. Methyl ferulic acid exerts anti-apoptotic effects on L-02 cells via the ROS-mediated signalingpathway. Int J Oncol. 2018 Jul;53(1):225-236. DOI:10.3892/ijo.2018.4379 |
| | 3,4-DIMETHOXYCINNAMIC ACID Preparation Products And Raw materials |
|