|
|
| | [(R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl]palladium(II) chloride Basic information |
| Product Name: | [(R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl]palladium(II) chloride | | Synonyms: | Dichloro[(R)-(+)-2,2'-bis(diphenylphosphino)-1,1'-binaphthyl]palladium(II),(R-BINAP)PdCl2;2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'-BINAPHTHYLPALLAD;[(R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl]palladium(II) chloride 97%;Palladium,[1,1'-(1R)-[1,1'-binaphthalene]-2,2'-diylbis[1,1-diphenylphosphine-kP]]dichloro-, (SP-4-2)-;((R)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl)dichloropalladium;Pd(R-BINAP)Cl2;[(S)-(+)-2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'-BINAPHTHYL]PALLADIUM(II)CHLORIDE;2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'-BINAPHTHYLPALLADIUM(II) CHLORIDE | | CAS: | 115826-95-4 | | MF: | C44H32Cl2P2Pd | | MW: | 800 | | EINECS: | 621-611-4 | | Product Categories: | Pd;BINAPs;Chiral Catalysts, Ligands, and Reagents;Privileged Ligands and Complexes | | Mol File: | 115826-95-4.mol | ![[(R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl]palladium(II) chloride Structure](CAS/GIF/115826-95-4.gif) |
| | [(R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl]palladium(II) chloride Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | Appearance | Light yellow to yellow Solid | | Optical Rotation | [α]24/D +682°, c = 0.5 in chloroform | | Sensitive | Moisture Sensitive | | InChIKey | VDHAUMFISVWIRX-UHFFFAOYSA-L | | SMILES | C1(C2=C3C=CC=CC3=CC=C2P(C2C=CC=CC=2)C2C=CC=CC=2)=C2C=CC=CC2=CC=C1P(C1C=CC=CC=1)C1C=CC=CC=1.[Pd](Cl)Cl | | CAS DataBase Reference | 115826-95-4(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | [(R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl]palladium(II) chloride Usage And Synthesis |
| Uses | ((R)-2,2''-Bis(diphenylphosphino)-1,1''-binaphthyl)dichloropalladium can be used as a catalyst. |
| | [(R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl]palladium(II) chloride Preparation Products And Raw materials |
|