|
|
| | (S)-(-)-2-ACETOXYPROPIONYL CHLORIDE Basic information |
| Product Name: | (S)-(-)-2-ACETOXYPROPIONYL CHLORIDE | | Synonyms: | (S)-(-)-O-ACETYLLACTOYL CHLORIDE;(S)-(-)-2-ACETOXYPROPIONYL CHLORIDE;(S)-2-ACETOXYPROPIONYL CHLORIDE;S-ACETOXYPROPIONYL CHLORIDE;O-ACETYL-L-LACTYL CHLORIDE;AP-CL;2-Acetoxy propionyl chloride;acetic acid (1-chloro-1-oxopropan-2-yl) ester | | CAS: | 36394-75-9 | | MF: | C5H7ClO3 | | MW: | 150.56 | | EINECS: | 420-610-4 | | Product Categories: | synthons | | Mol File: | 36394-75-9.mol |  |
| | (S)-(-)-2-ACETOXYPROPIONYL CHLORIDE Chemical Properties |
| alpha | -31o (C=4 IN CHLOROFORM) | | Boiling point | 50 °C5 mm Hg(lit.) | | density | 1.189 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.423(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,2-8°C | | solubility | Chloroform (Sparingly) | | form | clear liquid | | Specific Gravity | 1.19 | | color | Colorless to Light yellow | | Optical Rotation | [α]20/D 31°, c = 4 in chloroform | | BRN | 1722943 | | Stability: | Hygroscopic, Moisture sensitive | | InChI | InChI=1S/C5H7ClO3/c1-3(5(6)8)9-4(2)7/h3H,1-2H3/t3-/m0/s1 | | InChIKey | ALHZEIINTQJLOT-VKHMYHEASA-N | | SMILES | C(Cl)(=O)[C@@H](OC(C)=O)C | | CAS DataBase Reference | 36394-75-9(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34-43-22 | | Safety Statements | 26-36/37/39-45-23 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2918199890 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral Skin Corr. 1B Skin Sens. 1 |
| | (S)-(-)-2-ACETOXYPROPIONYL CHLORIDE Usage And Synthesis |
| Uses | Frequently used chiral building block. Also used to resolve a bicyclic α-hydroxylactone and to prepare chiral phosphonates used in an enantiomeric excess assay of unprotected amino acids. Useful chiral derivatizing agent. | | Purification Methods | It is moisture sensitive and is hydrolysed to the corresponding acid. Check the IR spectrum. If the OH band above 3000cm -1 is too large and broad then the mixture should be refluxed with pure acetyl chloride for 1hour, evaporated and distilled under reduced pressure. [Julia & Sans J Chromatographic Sci 17 651 1979, Dolittle & Heath J Org Chem 49 5041 1984, Beilstein 3 II 189.] |
| | (S)-(-)-2-ACETOXYPROPIONYL CHLORIDE Preparation Products And Raw materials |
|