| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1,4-Diazobicylco[3.2.2]nonane Basic information | | Uses |
| Product Name: | 1,4-Diazobicylco[3.2.2]nonane | | Synonyms: | (1s,5s)-1,4-diazabicyclo[3.2.2]nonane;1,4-Diazobicylco[3.2.2]nonane;1,4-Diazabicyclo[3.2.2]nonane, 95%;1,4-Diazabicyclo[3.2.2]nonane (7CI, 8CI, 9CI, ACI);1,4-Diazabicyclo[3.2.2]nonane;1,4-diazabiscyclo[3.2.2]nonylalkane | | CAS: | 283-38-5 | | MF: | C7H14N2 | | MW: | 126.2 | | EINECS: | | | Product Categories: | | | Mol File: | 283-38-5.mol | ![1,4-Diazobicylco[3.2.2]nonane Structure](CAS/GIF/283-38-5.gif) |
| | 1,4-Diazobicylco[3.2.2]nonane Chemical Properties |
| Boiling point | 180.0±8.0℃ (760 Torr) | | density | 1.03±0.1 g/cm3 (20 ºC 760 Torr) | | Fp | 71.9±9.4℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | Waxy Solid | | pka | 11.00±0.20(Predicted) | | color | Colorless to yellow | | InChI | InChI=1S/C7H14N2/c1-4-9-5-2-7(1)8-3-6-9/h7-8H,1-6H2 | | InChIKey | XJKNACDCUAFDHD-UHFFFAOYSA-N | | SMILES | N12CCC(CC1)NCC2 |
| | 1,4-Diazobicylco[3.2.2]nonane Usage And Synthesis |
| Uses | 1,4-Diazabicyclo[3.2.2]nonane is a hydrocarbon derivative that can be used as a pharmaceutical intermediate. | | Synthesis | GENERAL STEPS: To a stirred solution of 1,4-diazabicyclo[3.2.2]nonan-3-one (1.0 g, 7.2 mmol) in 1,4-dioxane (7.2 mL) was slowly added lithium aluminum hydride [2.0 M in THF] (4.1 mL, 8.2 mmol) at room temperature. Subsequently, the reaction mixture was heated to reflux, maintained for 6 h, and then cooled to room temperature. The reaction was quenched by stepwise addition of water (200 μL), 15% NaOH aqueous solution (200 μL) and water (600 μL). The mixture was filtered through a diatomaceous earth pad and washed with ethyl acetate (EtOAc). After combining the filtrates, they were concentrated under vacuum to afford 1,4-diazabicyclo[3.2.2]nonane (0.82 g, 90% yield), which was used for subsequent reactions without further purification. The 1H NMR (400 MHz, CDCl3) data of the product were as follows: δ 3.28-3.25 (m, 1H), 2.99-2.95 (m, 8H), 1.86-1.80 (m, 3H), 1.69-1.64 (m, 2H) ppm. | | References | [1] Synthetic Communications, 2006, vol. 36, # 3, p. 321 - 326
[2] Patent: WO2015/89067, 2015, A1. Location in patent: Page/Page column 124; 125
[3] Patent: US9126993, 2015, B2. Location in patent: Page/Page column 51
[4] Patent: WO2005/74940, 2005, A1. Location in patent: Page/Page column 28
[5] Patent: WO2009/24515, 2009, A1. Location in patent: Page/Page column 15 |
| | 1,4-Diazobicylco[3.2.2]nonane Preparation Products And Raw materials |
|