|
|
| | 2,5-Bis(trifluoromethyl)aniline Basic information |
| Product Name: | 2,5-Bis(trifluoromethyl)aniline | | Synonyms: | ALPHA,ALPHA,ALPHA,ALPHA',ALPHA',ALPHA'-HEXAFLUORO-2,5-XYLIDINE;2,5-DI(TRIFLUOROMETHYL)ANILINE;2,5-BIS(TRIFLUOROMETHYL)ANILINE;TIMTEC-BB SBB000691;2,5-BIS(TRIFLUOROMETHYL)AMILINE;2,5-Bis(trifluoromethyl)aniline 98%;2,5-Bis(trifluoromethyl)aniline98%;2,5-DIS(TRIFLUOROMETHYL)ANILINE | | CAS: | 328-93-8 | | MF: | C8H5F6N | | MW: | 229.12 | | EINECS: | 629-040-2 | | Product Categories: | Aniline series;Nitrogen Compounds;Amines;C8;Anilines, Aromatic Amines and Nitro Compounds;Fluorobenzene | | Mol File: | 328-93-8.mol |  |
| | 2,5-Bis(trifluoromethyl)aniline Chemical Properties |
| Boiling point | 70-71 °C15 mm Hg(lit.) | | density | 1.467 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.432(lit.) | | Fp | 160 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Oil | | pka | 0.24±0.10(Predicted) | | Specific Gravity | 1.467 | | color | Clear Colourless | | BRN | 2653046 | | InChI | InChI=1S/C8H5F6N/c9-7(10,11)4-1-2-5(6(15)3-4)8(12,13)14/h1-3H,15H2 | | InChIKey | XWMVIJUAZAEWIE-UHFFFAOYSA-N | | SMILES | C1(N)=CC(C(F)(F)F)=CC=C1C(F)(F)F | | CAS DataBase Reference | 328-93-8(CAS DataBase Reference) |
| Hazard Codes | Xn,T,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36/37/39-45-36 | | RIDADR | 2810 | | WGK Germany | 3 | | Hazard Note | Toxic/Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29214990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,5-Bis(trifluoromethyl)aniline Usage And Synthesis |
| Chemical Properties | Clear colorless liquid | | Uses | 2,5-Bis(trifluoromethyl)aniline is a haloalkul substituted aniline used in the preparation of anti-benign prostatic hyperplasia drug, Dutasteride (D735000). | | Uses | 2,5-Bis(trifluoromethyl)aniline may be used in chemical synthesis. | | Synthesis | Example 8: To an autoclave was added 1.05 g of Raney nickel catalyst (10 wt%) and 100 mL of isopropanol followed by 10.0 g of 2,5-bis(trifluoromethyl)nitrobenzene. Hydrogen was passed under stirring until the pressure reached 5 kg/cm2 and the temperature was raised to 70 °C. The reaction was continued at 70-90°C for 8 hours. After completion of the reaction, the temperature was allowed to drop to room temperature, the hydrogen pressure was released, the catalyst was removed by filtration and the filtrate was washed with isopropanol. The filtrate was concentrated to give 6.42 g of 2,5-bis(trifluoromethyl)aniline in 73% yield and 99.4% GC purity. The structure of the product was confirmed by GC-MS, 1H-NMR and 19F-NMR analysis. | | References | [1] Patent: EP1468983, 2004, A1. Location in patent: Page 6 [2] Journal of the American Chemical Society, 1953, vol. 75, p. 4967 [3] Patent: WO2011/150156, 2011, A2. Location in patent: Page/Page column 132 |
| | 2,5-Bis(trifluoromethyl)aniline Preparation Products And Raw materials |
|