| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Potassium tetranitroplatinate(II) Basic information |
| | Potassium tetranitroplatinate(II) Chemical Properties |
| storage temp. | Store at room temperature | | form | Powder | | color | white | | Water Solubility | It is slightly soluble in water. It is soluble in organic or non-aqueous solvent. | | Exposure limits | ACGIH: TWA 0.002 mg/m3 NIOSH: IDLH 4 mg/m3; TWA 0.002 mg/m3 | | InChI | 1S/2K.4NO2.Pt/c;;4*2-1-3;/q2*+1;;;;;-2 | | InChIKey | IBATUMPEEVPRPS-UHFFFAOYSA-N | | SMILES | [K+].[K+].[O-][N+](=O)[Pt--]([N+]([O-])=O)([N+]([O-])=O)[N+]([O-])=O | | EPA Substance Registry System | Platinate(2-), tetrakis(nitrito-.kappa.N)-, dipotassium, (SP-4-1)- (13815-39-9) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | RTECS | TP1875000 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | Potassium tetranitroplatinate(II) Usage And Synthesis |
| Chemical Properties | white powder(s) [STR93] | | Uses | Potassium tetranitroplatinate(II) is used widely as laboratory chemicals and in manufacture of substances. |
| | Potassium tetranitroplatinate(II) Preparation Products And Raw materials |
|