| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | Octadecanoic acid, 10-oxo- Basic information |
| | Octadecanoic acid, 10-oxo- Chemical Properties |
| Melting point | 77 °C | | Boiling point | 444.1±28.0 °C(Predicted) | | density | 0.940±0.06 g/cm3(Predicted) | | pka | 4.78±0.10(Predicted) | | InChI | InChI=1S/C18H34O3/c1-2-3-4-5-8-11-14-17(19)15-12-9-6-7-10-13-16-18(20)21/h2-16H2,1H3,(H,20,21) | | InChIKey | BGKROBBCCGUUCF-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCCCCCCC(=O)CCCCCCCC |
| | Octadecanoic acid, 10-oxo- Usage And Synthesis |
| Definition | ChEBI: 10-Oxooctadecanoic acid is a long-chain fatty acid. |
| | Octadecanoic acid, 10-oxo- Preparation Products And Raw materials |
|