|
|
| | 2-amino-3-(1H-indol-3-yl)propanamide Basic information |
| | 2-amino-3-(1H-indol-3-yl)propanamide Chemical Properties |
| Melting point | 120-121 °C | | Boiling point | 498.7±40.0 °C(Predicted) | | density | 1.302±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | form | Crystalline Powder | | pka | 15.99±0.50(Predicted) | | color | Off-white | | InChI | 1S/C11H13N3O/c12-9(11(13)15)5-7-6-14-10-4-2-1-3-8(7)10/h1-4,6,9,14H,5,12H2,(H2,13,15) | | InChIKey | JLSKPBDKNIXMBS-UHFFFAOYSA-N | | SMILES | NC(C(N)=O)CC1=CNC2=C1C=CC=C2 |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2-amino-3-(1H-indol-3-yl)propanamide Usage And Synthesis |
| | 2-amino-3-(1H-indol-3-yl)propanamide Preparation Products And Raw materials |
|