1,3,7-TRIMETHYLURIC ACID manufacturers
|
| | 1,3,7-TRIMETHYLURIC ACID Basic information |
| Product Name: | 1,3,7-TRIMETHYLURIC ACID | | Synonyms: | 1,3,7-Trimethyl-7,9-dihydro-1H-purine-2,6,8(3H)-trione;1H-Purine-2,6,8(3H)-trione, 7,9-dihydro-1,3,7-trimethyl-;7,9-dihydro-1,3,7-trimethyl-1h-purine-2,6,8(3h)-trione;8(3h)-trione,7,9-dihydro-1,3,7-trimethyl-1h-purine-6;Ba 2753;ba2753;Uric acid, 1,3,7-trimethyl-;2,6,8-TRIHYDROXY-1,3,7-TRIMETHYLPURINE | | CAS: | 5415-44-1 | | MF: | C8H10N4O3 | | MW: | 210.19 | | EINECS: | 226-507-9 | | Product Categories: | | | Mol File: | 5415-44-1.mol |  |
| | 1,3,7-TRIMETHYLURIC ACID Chemical Properties |
| Melting point | ≥300 °C | | Boiling point | 349.7°C (rough estimate) | | density | 1.3649 (rough estimate) | | refractive index | 1.6590 (estimate) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) | | form | Solid | | pka | 5.85±0.70(Predicted) | | color | White to Pale Beige | | Water Solubility | 24mg/L(room temperature) | | InChI | InChI=1S/C8H10N4O3/c1-10-4-5(9-7(10)14)11(2)8(15)12(3)6(4)13/h1-3H3,(H,9,14) | | InChIKey | BYXCFUMGEBZDDI-UHFFFAOYSA-N | | SMILES | N1(C)C2=C(N(C)C(=O)N(C)C2=O)NC1=O |
| WGK Germany | 2 | | RTECS | UP0783750 |
| | 1,3,7-TRIMETHYLURIC ACID Usage And Synthesis |
| Uses | 1,3,7-Trimethyluric Acid is a caffeine derivative, and a methyl derivative of uric acid. Detected as a urine marker of caffeine consumption. | | Definition | ChEBI: An oxopurine in which the purine ring is substituted by oxo groups at positions 2, 6, and 8, and the nitrogens at positions 1, 3, and 7 are substituted by methyl groups. It is a metabolite of caffeine. | | Purification Methods | Crystallise it from water and dry it at 100o in a vacuum. It has UV: 289nm (pH 2.5). [Beilstein 26 III/IV 2623.] |
| | 1,3,7-TRIMETHYLURIC ACID Preparation Products And Raw materials |
| Raw materials | 1,3,7-trimethyl-8-nitro-purine-2,6-dione-->1,7-DIMETHYLURIC ACID-->6-Amino-1,3-dimethyl-1,2,3,4-tetrahydropyrimidine-2,4-dione-->6-Amino-1,3-dimethyl-5-(methylamino)-2,4(1H,3H)-pyrimidinedione-->8-chloro-3,7-dihydro-1,3,7-trimethyl-1H-purine-2,6-dione-->1,3-Dimethyl-8-nitro-3,7-dihydro-1H-purine-2,6-dione-->Uric acid-->Iodomethane-->Dimethyl carbonate-->Caffeine-->1,1'-Carbonyldiimidazole | | Preparation Products | Theophylline-->4-METHYL-2-HEPTENE |
|