|
|
| | 2-Aminoimidazole hemisulfate Basic information |
| | 2-Aminoimidazole hemisulfate Chemical Properties |
| Melting point | 270 °C (dec.) (lit.) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Water (Sparingly) | | form | Crystals or Crystalline Powder | | color | Pale brown to brown | | BRN | 4726750 | | InChI | InChI=1S/2C3H5N3.H2O4S/c2*4-3-5-1-2-6-3;1-5(2,3)4/h2*1-2H,(H3,4,5,6);(H2,1,2,3,4) | | InChIKey | KUWRLKJYNASPQZ-UHFFFAOYSA-N | | SMILES | S(O)(O)(=O)=O.C1(N)=NC=CN1.C1(N)=NC=CN1 | | CAS DataBase Reference | 1450-93-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | IRRITANT, KEEP COLD | | HS Code | 29332990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Aminoimidazole hemisulfate Usage And Synthesis |
| Chemical Properties | Brown Crystals (Contains Few Dark Brown Chunks) | | Uses | 2-Aminoimidazole sulfate was used in the synthesis of chlorohydrin. | | Synthesis Reference(s) | Tetrahedron Letters, 43, p. 593, 2002 DOI: 10.1016/S0040-4039(01)02226-2 |
| | 2-Aminoimidazole hemisulfate Preparation Products And Raw materials |
|