| Company Name: |
Shanghai Tauto Biotech Co., Ltd.
|
| Tel: |
021-51320588 |
| Email: |
tauto@tautobiotech.com |
| Products Intro: |
Product Name:Rubrofusarin
CAS:3567-00-8
Purity:NLT 95% HPLC Package:10Mg;20Mg;50Mg;100Mg to graMs.Not More than tens of graMs. Remarks:BVT-0395-M005
|
rubrofusarin manufacturers
- Rubrofusarin
-
- $2800.00 / 1g
-
2024-11-28
- CAS:3567-00-8
- Min. Order: 1g
- Purity: 98
- Supply Ability: 50 Kg
|
| | rubrofusarin Basic information |
| Product Name: | rubrofusarin | | Synonyms: | rubrofusarin;5,6-Dihydroxy-8-methoxy-2-methyl-4H-naphtho[2,3-b]pyran-4-one;NSC 258316;4H-Naphtho[2,3-b]pyran-4-one, 5,6-dihydroxy-8-methoxy-2-methyl-;Rusbrofusarin;Rubrofusarin, tyrosinase inhibitor | | CAS: | 3567-00-8 | | MF: | C15H12O5 | | MW: | 272.25 | | EINECS: | | | Product Categories: | | | Mol File: | 3567-00-8.mol |  |
| | rubrofusarin Chemical Properties |
| Melting point | 214℃ (benzene ) | | Boiling point | 438.7±45.0 °C(Predicted) | | density | 1.432±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | form | powder | | pka | 3.83±0.40(Predicted) | | color | yellow to orange | | InChI | 1S/C15H12O5/c1-7-3-10(16)14-12(20-7)5-8-4-9(19-2)6-11(17)13(8)15(14)18/h3-6,17-18H,1-2H3 | | InChIKey | FPNKCZKRICBAKG-UHFFFAOYSA-N | | SMILES | [o]1c2c([c](cc1C)=O)c(c3c(c2)cc(cc3O)OC)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Irrit. 2 |
| | rubrofusarin Usage And Synthesis |
| Uses | Rubrofusarin is useful for treating chronic restraint stress-induced depressive symptoms. | | Definition | ChEBI: A member of the class of benzochromenones that is benzo[g]chromen-4-one carrying two additional hydroxy substituents at positions 5 and 6 as well as methyl and methoxy substituents at positions 2 and 8 respectively. An orange polyketide pigmen
that is a common intermediate in many different fungal biosynthetic pathways. | | Biochem/physiol Actions | Rubrofusarin is an orange polyketide pigment produced by Fusarium graminearum and other fungal species that exhibit potent anti-cancer and anti-mycobacterial activities. Rubrofusarin is a mycotoxin that inhibits human DNA topoisomerase II-α.. Additionally, Rubrofusarin shows a significant anti-estrogenic activity. | | storage | +4°C |
| | rubrofusarin Preparation Products And Raw materials |
|