| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
|
| | 2-Amino-4,5-dichlorobenzaldehyde Basic information |
| | 2-Amino-4,5-dichlorobenzaldehyde Chemical Properties |
| Melting point | 139-141 °C | | Boiling point | 329.9±42.0 °C(Predicted) | | density | 1.492±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | -1.22±0.13(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C7H5Cl2NO/c8-5-1-4(3-11)7(10)2-6(5)9/h1-3H,10H2 | | InChIKey | PQLKBWVGBYRNQL-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC(Cl)=C(Cl)C=C1N |
| | 2-Amino-4,5-dichlorobenzaldehyde Usage And Synthesis |
| | 2-Amino-4,5-dichlorobenzaldehyde Preparation Products And Raw materials |
|