|
|
| | N,N-Bis(2-chloroethyl)carbamoyl chloride Basic information |
| Product Name: | N,N-Bis(2-chloroethyl)carbamoyl chloride | | Synonyms: | bis(2-chloroethyl)-carbamicchlorid;bis(2-chloroethyl)-carbamoylchlorid;bis(2-chloroethyl)carbamoylchloride;bischloroethylcarbamoylchloride;tl460;N,N-BIS(2-CHLOROETHYL)CARBAMOYL CHLORIDE;bis-(2-Chloroethyl)carbamic chloride;Bis-(2-chloro ethyl)carbamoyl hydrochloride | | CAS: | 2998-56-3 | | MF: | C5H8Cl3NO | | MW: | 204.48 | | EINECS: | 221-075-8 | | Product Categories: | | | Mol File: | 2998-56-3.mol |  |
| | N,N-Bis(2-chloroethyl)carbamoyl chloride Chemical Properties |
| Melting point | 101-103 °C | | Boiling point | 125°C 3mm | | density | 1,4 g/cm3 | | refractive index | 1.5060-1.5100 | | storage temp. | Inert atmosphere,Room Temperature | | form | clear liquid | | pka | -2.30±0.70(Predicted) | | color | Colorless to Light yellow | | InChI | InChI=1S/C5H8Cl3NO/c6-1-3-9(4-2-7)5(8)10/h1-4H2 | | InChIKey | JAHXVUPWHXMPLG-UHFFFAOYSA-N | | SMILES | C(Cl)(=O)N(CCCl)CCCl |
| Hazard Codes | T | | Risk Statements | 34-43-25 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 3265 | | RTECS | FD2200000 | | HS Code | 2929.90.5090 | | HazardClass | 8 | | PackingGroup | II | | Toxicity | mouse,LC,inhalation,> 1540mg/m3/10 (1540mg/m3),National Defense Research Committee, Office of Scientific Research and Development, Progress Report.Vol. NDCrc-132, Pg. Nov, 1942. |
| | N,N-Bis(2-chloroethyl)carbamoyl chloride Usage And Synthesis |
| | N,N-Bis(2-chloroethyl)carbamoyl chloride Preparation Products And Raw materials |
|