|
|
| | 10-bromocarbamazepine Basic information |
| Product Name: | 10-bromocarbamazepine | | Synonyms: | 10-BroMo-5H-Dibenz[B,F]Azepine-5-CarboxaMide;10-BroMo-5H-dibenzo[b,f]azepine-5-carboxaMide;Carbamazepine EP Impurity G;5-bromobenzo[b][1]benzazepine-11-carboxamide;Carbamazepine Impurity 7;Carbamazepine EP Imp G;Carbamazepine Impurity 7(Carbamazepine EP Impurity G）;Carbamazepine EP Impurity G (10-Bromocarbamazepine) | | CAS: | 59690-97-0 | | MF: | C15H11BrN2O | | MW: | 315.16 | | EINECS: | | | Product Categories: | | | Mol File: | 59690-97-0.mol |  |
| | 10-bromocarbamazepine Chemical Properties |
| Boiling point | 463.1±55.0 °C(Predicted) | | density | 1.584±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 13.81±0.40(Predicted) | | Major Application | pharmaceutical small molecule | | InChI | 1S/C15H11BrN2O/c16-12-9-10-5-1-3-7-13(10)18(15(17)19)14-8-4-2-6-11(12)14/h1-9H,(H2,17,19) | | InChIKey | FGWUKVYDIGVLTD-UHFFFAOYSA-N | | SMILES | BrC1=Cc2c(cccc2)N(c3c1cccc3)C(=O)N |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral
Repr. 1A
Resp. Sens. 1A
Skin Sens. 1A
STOT SE 3 |
| | 10-bromocarbamazepine Usage And Synthesis |
| Uses | 10-Bromo-5H-dibenzo[b,f]azepine-5-carboxamide is a Carbamazepine (C175840(P)) impurity, which has been used in treatment of pain associated with trigeminal neuralgia. It is an anticonvulsant, neuroprotective & neuroresearch product. |
| | 10-bromocarbamazepine Preparation Products And Raw materials |
|