|
|
| | Nemonoxacin Impurity 7 Basic information |
| Product Name: | Nemonoxacin Impurity 7 | | Synonyms: | Nemonoxacin Impurity 7;3-Quinolinecarboxylic acid, 7-[(3S,5S)-3-[[(2R)-3-carboxy-2-hydroxy-1-oxopropyl]amino]-5-methyl-1-piperidinyl]-1-cyclopropyl-1,4-dihydro-8-methoxy-4-oxo-;Nemonoxacin Impurity 24;7-((3S,5S)-3-((R)-3-carboxy-2-hydroxypropanamido)-5-methylpiperidin-1-yl)-1-cyclopropyl-8-methoxy-4-oxo-1,4-dihydroquinoline-3-carboxylic acid;Nanofloxacin Impurity 08 | | CAS: | 2770004-81-2 | | MF: | C24H29N3O8 | | MW: | 487.5 | | EINECS: | | | Product Categories: | | | Mol File: | 2770004-81-2.mol |  |
| | Nemonoxacin Impurity 7 Chemical Properties |
| Boiling point | 829.6±65.0 °C(predicted) | | density | 1.48±0.1 g/cm3(Temp: 20 °C; Press: 760 Torr)(predicted) | | pka | 4.33±0.10(predicted) | | InChIKey | ZAAFRZSNTWVHCZ-ZJNRKIDTSA-N | | SMILES | O(C1C(N2C[C@H](C[C@@H](C2)NC(=O)[C@H](O)CC(=O)O)C)=CC=C2C(C(=CN(C3CC3)C=12)C(=O)O)=O)C |
| | Nemonoxacin Impurity 7 Usage And Synthesis |
| | Nemonoxacin Impurity 7 Preparation Products And Raw materials |
|