|
|
| | 2-Chloro-4-(trifluoromethyl)phenylboronic acid Basic information |
| | 2-Chloro-4-(trifluoromethyl)phenylboronic acid Chemical Properties |
| Melting point | 70-72 | | Boiling point | 287.6±50.0 °C(Predicted) | | density | 1.49±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 7.97±0.58(Predicted) | | color | White to Almost white | | InChI | 1S/C7H5BClF3O2/c9-4-1-2-6(8(13)14)5(3-4)7(10,11)12/h1-3,13-14H | | InChIKey | YAPBOBGBYQQYHX-UHFFFAOYSA-N | | SMILES | OB(C1=CC=C(Cl)C=C1C(F)(F)F)O | | CAS DataBase Reference | 313545-41-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36-36/37/38 | | Safety Statements | 26-37 | | HazardClass | IRRITANT | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| Provider | Language |
|
ALFA
| English |
| | 2-Chloro-4-(trifluoromethyl)phenylboronic acid Usage And Synthesis |
| | 2-Chloro-4-(trifluoromethyl)phenylboronic acid Preparation Products And Raw materials |
|