|
|
| | Deacetyl asperulosidic acid methyl ester Basic information |
| Product Name: | Deacetyl asperulosidic acid methyl ester | | Synonyms: | 6-alpha-Hydroxygeniposide;Deacetyl asperulosidic acid methyl ester;6-Epiferetoside;Deacetylasperulosidic acid methyl ester, 98%, from Kadsura interior;Methyl deacetylasperulosidate;Deacetylasperuloside acid methyl ester;Cyclopenta[c]pyran-4-carboxylic acid, 1-(β-D-glucopyranosyloxy)-1,4a,5,7a-tetrahydro-5-hydroxy-7-(hydroxymethyl)-, methyl ester, (1S,4aS,5S,7aS)-;6α-hydroxygeniposide | | CAS: | 52613-28-2 | | MF: | C17H24O11 | | MW: | 404.37 | | EINECS: | | | Product Categories: | | | Mol File: | 52613-28-2.mol |  |
| | Deacetyl asperulosidic acid methyl ester Chemical Properties |
| Boiling point | 696.3±55.0 °C(Predicted) | | density | 1.61±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO : 250 mg/mL (618.25 mM; Need ultrasonic)Methanol : 62.5 mg/mL (154.56 mM; Need ultrasonic) | | pka | 12.80±0.70(Predicted) | | form | Powder | | color | White to off-white | | InChIKey | WSGPLSDARZNMCW-FCVLBCLDSA-N | | SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O)O[C@@H]2OC=C([C@@H]3[C@H]2C(=C[C@@H]3O)CO)C(=O)OC |
| Safety Statements | 24/25 | | WGK Germany | WGK 3 | | HS Code | 29389090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Deacetyl asperulosidic acid methyl ester Usage And Synthesis |
| Chemical Properties | Soluble in methanol, derived from the plant Ceratonia suffruticosa. | | Uses | Methyl deacetylasperulosidate is an iridoid and shows purgative effects in mice and lowers the blood glucose level in normal mice[1]. | | References | [1] Lucia Maria Conserva, et al. Borreria and Spermacoce species (Rubiaceae): A review of their ethnomedicinal properties, chemical constituents, and biological activities. Pharmacogn Rev. 2012 Jan;6(11):46-55. DOI:10.4103/0973-7847.95866 |
| | Deacetyl asperulosidic acid methyl ester Preparation Products And Raw materials |
|