|
|
| | N-HEPTANEBORONIC ACID Basic information |
| | N-HEPTANEBORONIC ACID Chemical Properties |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H17BO2/c1-3-4-5-6-7(2)8(9)10/h7,9-10H,3-6H2,1-2H3 | | InChIKey | GZDXOIBYOWDWKV-UHFFFAOYSA-N | | SMILES | CC(B(O)O)CCCCC |
| | N-HEPTANEBORONIC ACID Usage And Synthesis |
| Chemical Properties | White to off-white crystalline powder | | Uses | Heptylboronic acid is an inhibitor of α-chymotrypsin. |
| | N-HEPTANEBORONIC ACID Preparation Products And Raw materials |
|