|
|
| | 2,5-DIFLUORO-4-HYDROXYBENZALDEHYDE Basic information |
| | 2,5-DIFLUORO-4-HYDROXYBENZALDEHYDE Chemical Properties |
| Melting point | 145-148℃ | | Boiling point | 232.1±35.0 °C(Predicted) | | density | 1.464±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 5.54±0.23(Predicted) | | Water Solubility | Slightly soluble in water. | | Sensitive | Air Sensitive | | InChI | InChI=1S/C7H4F2O2/c8-5-2-7(11)6(9)1-4(5)3-10/h1-3,11H | | InChIKey | FFPHRYLGIPAZBL-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC(F)=C(O)C=C1F |
| | 2,5-DIFLUORO-4-HYDROXYBENZALDEHYDE Usage And Synthesis |
| Uses | 2,5-Difluoro-4-hydroxybenzaldehyde is used as primary and secondary intermediate and as pharmaceutical intermediate. |
| | 2,5-DIFLUORO-4-HYDROXYBENZALDEHYDE Preparation Products And Raw materials |
|