|
|
| | Benzo[c][1,2,5]oxadiazole-5-boronic acid, pinacol ester Basic information |
| Product Name: | Benzo[c][1,2,5]oxadiazole-5-boronic acid, pinacol ester | | Synonyms: | Benzo[c][1,2,5]oxadiazole-5-boronic acid, pinacol ester;5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZOFURAZAN;5-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-benzo[1,2,5]oxadiazole;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzoxadiazole;5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzoxadiazole;2,1,3-Benzoxadiazole, 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-;Benzo[c][1,2,5]oxadiazole-5-boronic acid pinacol ester | | CAS: | 1073355-14-2 | | MF: | C12H15BN2O3 | | MW: | 246.07 | | EINECS: | | | Product Categories: | Boronate Esters;Boronic Acids and Derivatives;Heteroaryl | | Mol File: | 1073355-14-2.mol | ![Benzo[c][1,2,5]oxadiazole-5-boronic acid, pinacol ester Structure](CAS/GIF/1073355-14-2.gif) |
| | Benzo[c][1,2,5]oxadiazole-5-boronic acid, pinacol ester Chemical Properties |
| Melting point | 87-91 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Powder | | color | White to yellow to tan | | InChI | 1S/C12H15BN2O3/c1-11(2)12(3,4)17-13(16-11)8-5-6-9-10(7-8)15-18-14-9/h5-7H,1-4H3 | | InChIKey | MQXANAGMQAYTMV-UHFFFAOYSA-N | | SMILES | CC1(C)OB(OC1(C)C)c2ccc3nonc3c2 |
| WGK Germany | 3 | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids |
| | Benzo[c][1,2,5]oxadiazole-5-boronic acid, pinacol ester Usage And Synthesis |
| | Benzo[c][1,2,5]oxadiazole-5-boronic acid, pinacol ester Preparation Products And Raw materials |
|