|
|
| | 5-Benzyl-4-methyl-4H-1,2,4-triazole-3-thiol Basic information |
| Product Name: | 5-Benzyl-4-methyl-4H-1,2,4-triazole-3-thiol | | Synonyms: | Albb-003321;5-benzyl-4-methyl-4H-1,2,4-triazole-3-thiol(SALTDATA: FREE);4-methyl-5-(phenylmethyl)-2H-1,2,4-triazole-3-thione;5-(benzyl)-4-methyl-2H-1,2,4-triazole-3-thione;5-benzyl-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione;3H-1,2,4-Triazole-3-thione, 2,4-dihydro-4-methyl-5-(phenylmethyl)-;5-Benzyl-4-methyl-4H-1,2,4-triazol-3-yl hydrosulfide;5-Benzyl-4-methyl-4H-1,2,4-triazole-3-thiol | | CAS: | 51291-31-7 | | MF: | C10H11N3S | | MW: | 205.28 | | EINECS: | | | Product Categories: | | | Mol File: | 51291-31-7.mol |  |
| | 5-Benzyl-4-methyl-4H-1,2,4-triazole-3-thiol Chemical Properties |
| Melting point | 155 °C | | Boiling point | 300.4±35.0 °C(Predicted) | | density | 1.24±0.1 g/cm3(Predicted) | | pka | 9.73±0.20(Predicted) | | form | solid | | InChI | 1S/C10H11N3S/c1-13-9(11-12-10(13)14)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H,12,14) | | InChIKey | MJOLNPWSILTXMX-UHFFFAOYSA-N | | SMILES | SC1=NN=C(N1C)CC2=CC=CC=C2 |
| WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 5-Benzyl-4-methyl-4H-1,2,4-triazole-3-thiol Usage And Synthesis |
| | 5-Benzyl-4-methyl-4H-1,2,4-triazole-3-thiol Preparation Products And Raw materials |
|