- N-Acetyl-L-aspartic acid
-
- $32.00 / 1kg
-
2025-09-25
- CAS:997-55-7
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | N-Acetyl-L-aspartic acid Basic information |
| | N-Acetyl-L-aspartic acid Chemical Properties |
| Melting point | 137-140 °C(lit.) | | alpha | 52 º (c=1, HAc) | | Boiling point | 425.3±35.0 °C(Predicted) | | density | 1.422±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Aqueous Acid (Slightly, Sonicated), DMSO (Slightly, Heated) | | form | Solid | | pka | 3.14±0.10(Predicted) | | color | White to Off-Whiite | | Optical Rotation | [α]20/D +12±1°, c = 2% in 6 M HCl | | Merck | 13,845 | | BRN | 1726198 | | Major Application | peptide synthesis | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChI | 1S/C6H9NO5/c1-3(8)7-4(6(11)12)2-5(9)10/h4H,2H2,1H3,(H,7,8)(H,9,10)(H,11,12)/t4-/m0/s1 | | InChIKey | OTCCIMWXFLJLIA-BYPYZUCNSA-N | | SMILES | CC(=O)N[C@@H](CC(O)=O)C(O)=O | | CAS DataBase Reference | 997-55-7(CAS DataBase Reference) | | EPA Substance Registry System | L-Aspartic acid, N-acetyl- (997-55-7) |
| Safety Statements | 22-24/25 | | WGK Germany | 1 | | RTECS | CI9098600 | | HS Code | 2924190090 | | Storage Class | 11 - Combustible Solids |
| | N-Acetyl-L-aspartic acid Usage And Synthesis |
| Uses | Nutritional supplement; in forensic determination of age. | | Uses | N-Acetyl-L-aspartic acid can be used as a reactant to synthesize:
- Protected homoserine γ-lactones by selective reduction and acid-catalyzed cyclization reaction.
- Racemic amino substituted succinimide derivatives via cyclocondensation reaction.
| | Uses | N-Acetyl-L-aspartic acid is used in biological studies for metabolic alterations associated with schizophrenia. | | Definition | ChEBI: An N-acyl-L-aspartic acid in which the acyl group is specified as acetyl. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | N-Acetyl-L-aspartic acid Preparation Products And Raw materials |
|