|
|
| | 2-Chloro-6-fluorophenol Basic information |
| | 2-Chloro-6-fluorophenol Chemical Properties |
| Melting point | 62-65 °C (lit.) | | Boiling point | 160.6±20.0 °C(Predicted) | | density | 1.408±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Methanol | | pka | 7.23±0.10(Predicted) | | form | powder to crystal | | color | White to Light yellow | | BRN | 1936441 | | InChI | InChI=1S/C6H4ClFO/c7-4-2-1-3-5(8)6(4)9/h1-3,9H | | InChIKey | QIAQIYQASAWZPP-UHFFFAOYSA-N | | SMILES | C1(O)=C(F)C=CC=C1Cl | | CAS DataBase Reference | 2040-90-6(CAS DataBase Reference) | | EPA Substance Registry System | Phenol, 2-chloro-6-fluoro- (2040-90-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | 1759 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | IRRITANT, IRRITANT-HARMFUL | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29081990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Eye Dam. 1 Muta. 1B Repr. 2 Skin Corr. 1B |
| | 2-Chloro-6-fluorophenol Usage And Synthesis |
| | 2-Chloro-6-fluorophenol Preparation Products And Raw materials |
|