| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | 2-fluoroisophthalic acid Basic information |
| Product Name: | 2-fluoroisophthalic acid | | Synonyms: | 2-fluoroisophthalic acid;2-fluorobenzene-1,3-dicarboxylic acid;2-fluoro-1,3-Benzenedicarboxylic acid;2-fluorobenzene-1,3-dicarboxylic aci;1,3-Benzenedicarboxylic acid, 2-fluoro- | | CAS: | 1583-65-9 | | MF: | C8H5FO4 | | MW: | 184.12 | | EINECS: | | | Product Categories: | | | Mol File: | 1583-65-9.mol |  |
| | 2-fluoroisophthalic acid Chemical Properties |
| Melting point | 286-287 °C | | Boiling point | 393.6±27.0 °C(Predicted) | | density | 1.551±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 2.60±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H5FO4/c9-6-4(7(10)11)2-1-3-5(6)8(12)13/h1-3H,(H,10,11)(H,12,13) | | InChIKey | DWOLBEJAJWCIGK-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)=CC=CC(C(O)=O)=C1F |
| | 2-fluoroisophthalic acid Usage And Synthesis |
| | 2-fluoroisophthalic acid Preparation Products And Raw materials |
|