|
|
| | 3-(N-Boc-ethylamino) azetidine Basic information |
| | 3-(N-Boc-ethylamino) azetidine Chemical Properties |
| Boiling point | 266℃ | | density | 1.03 | | Fp | 115℃ | | storage temp. | 2-8°C(protect from light) | | form | solid | | pka | 10.21±0.40(Predicted) | | InChI | 1S/C10H20N2O2/c1-5-11-8-6-12(7-8)9(13)14-10(2,3)4/h8,11H,5-7H2,1-4H3 | | InChIKey | ZXVCULTZOWFSRS-UHFFFAOYSA-N | | SMILES | CCNC1CN(C(OC(C)(C)C)=O)C1 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 3-(N-Boc-ethylamino) azetidine Usage And Synthesis |
| Uses | 3-(N-Boc-ethylamino) azetidine is an azetidine derivative used in the preparation of modulators of histamine H4 receptor activity. |
| | 3-(N-Boc-ethylamino) azetidine Preparation Products And Raw materials |
|