|
|
| | ent S-(+)-Atomoxetine Hydrochloride Basic information |
| | ent S-(+)-Atomoxetine Hydrochloride Chemical Properties |
| Melting point | 162-163℃ | | Boiling point | 180-200 °C(Press: 0.5 Torr) | | storage temp. | 2-30°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | Pale Brown | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C17H21NO.ClH/c1-14-8-6-7-11-16(14)19-17(12-13-18-2)15-9-4-3-5-10-15;/h3-11,17-18H,12-13H2,1-2H3;1H/t17-;/m0./s1 | | InChIKey | LUCXVPAZUDVVBT-LMOVPXPDSA-N | | SMILES | [Cl-].N(CC[C@H](Oc2c(cccc2)C)c1ccccc1)C.[H+] |
| WGK Germany | WGK 3 | | HS Code | 2922199695 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Inhalation
Acute Tox. 3 Oral |
| | ent S-(+)-Atomoxetine Hydrochloride Usage And Synthesis |
| Uses | The enatiomer of Atomoxetine, a Norepinephrine uptake blocker |
| | ent S-(+)-Atomoxetine Hydrochloride Preparation Products And Raw materials |
| Raw materials | 1,3-Propanediol, 1-phenyl-, 3-methanesulfonate, (1R)--->1,3-Propanediol, 1-phenyl-, 3-(4-methylbenzenesulfonate)-->Benzenepropanoic acid, β-(1-oxobutoxy)-, ethyl ester-->(S)-Tomoxetine-->Atomoxetine hydrochloride-->Ethyl-3-hydroxy-3-phenyl propionate-->(S)-3-Chloro-1-phenyl-1-[2-methyl-phenoxyl]propane-->(+)-Ethyl (R)-3-hydroxy-3-phenylpropionate-->(R)-1-Phenyl-1,3-propanediol-->(1R)-3-Chloro-1-phenyl-propan-1-ol-->Benzaldehyde-->Methylamine-->o-Cresol |
|