|
|
| | 3,5-Dibromo-4-cyanopyridine, 97% Basic information |
| Product Name: | 3,5-Dibromo-4-cyanopyridine, 97% | | Synonyms: | 3,5-Dibromo-4-cyanopyridine, 97%;4-Cyano-3,5 dibroMopyridine;4-Pyridinecarbonitrile, 3,5-dibroMo-;3,5-Dibromopyridine-4-carbonitrile 97%;3,5-dibromo-4-Pyridinecarbonitrile;3,5-dibromoisonicotinonitrile
C6H2Br2N2
261.90;3,5-dibroMopyridine-4-carbonitrile;3,5-dibroMo-isonicotinonitrile | | CAS: | 870244-34-1 | | MF: | C6H2Br2N2 | | MW: | 261.9 | | EINECS: | | | Product Categories: | | | Mol File: | 870244-34-1.mol |  |
| | 3,5-Dibromo-4-cyanopyridine, 97% Chemical Properties |
| Melting point | 149-151°C | | Boiling point | 317.6±42.0 °C(Predicted) | | density | 2.19±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | solid | | pka | -2.85±0.28(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C6H2Br2N2/c7-5-2-10-3-6(8)4(5)1-9/h2-3H | | InChIKey | FHVATNRRDOWTPX-UHFFFAOYSA-N | | SMILES | C1=NC=C(Br)C(C#N)=C1Br |
| Hazard Codes | T | | Risk Statements | 25-41-43 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN3439 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29333990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Dam. 1
Skin Sens. 1 |
| | 3,5-Dibromo-4-cyanopyridine, 97% Usage And Synthesis |
| | 3,5-Dibromo-4-cyanopyridine, 97% Preparation Products And Raw materials |
|