|
|
| | 4'-CHLORO-BIPHENYL-2-YLAMINE Basic information |
| Product Name: | 4'-CHLORO-BIPHENYL-2-YLAMINE | | Synonyms: | 4'-CHLORO[1,1'-BIPHENYL]-2-AMINE;4'-CHLORO-1,1'-BIPHENYL-2-AMINE HYDROCHLORIDE;4'-CHLORO-BIPHENYL-2-YLAMINE;4'-CHLORO-BIPHENYL-2-YLAMINE HYDROCHLORIDE;AKOS BAR-0110;[2-(4-chlorophenyl)phenyl]amine;2-(4-chlorophenyl)aniline;2-Amino-4'-chlorobiphenyl hydrochloride | | CAS: | 1204-44-0 | | MF: | C12H10ClN | | MW: | 203.67 | | EINECS: | 601-706-7 | | Product Categories: | | | Mol File: | 1204-44-0.mol |  |
| | 4'-CHLORO-BIPHENYL-2-YLAMINE Chemical Properties |
| Melting point | 45.0 to 49.0 °C | | Boiling point | 334.6±17.0 °C(Predicted) | | density | 1.205±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.26±0.10(Predicted) | | color | Off-White to Pale Beige | | InChI | InChI=1S/C12H10ClN/c13-10-7-5-9(6-8-10)11-3-1-2-4-12(11)14/h1-8H,14H2 | | InChIKey | JPBWZIPCMDZOPM-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(Cl)C=C2)=CC=CC=C1N | | CAS DataBase Reference | 1204-44-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | Hazard Note | Irritant | | HS Code | 2921490090 |
| | 4'-CHLORO-BIPHENYL-2-YLAMINE Usage And Synthesis |
| Uses | 4''-Chlorobiphenyl-2-ylamine is used as a reagent in the synthesis of Boscalid (B675850); a fungicide belonging to the class of carboxamides. Boscalid acts by inhibiting spore germination and germ tube elongation, and is also effective on all other stages of fungal development. Boscalid is used in the agriculture to protect crops from gray mold, powdery mildew, and other fungus. |
| | 4'-CHLORO-BIPHENYL-2-YLAMINE Preparation Products And Raw materials |
|