|
|
| | CIS-4,7,10,13,16,19-DOCOSAHEXAENOIC ACID ETHYL ESTER Basic information |
| Product Name: | CIS-4,7,10,13,16,19-DOCOSAHEXAENOIC ACID ETHYL ESTER | | Synonyms: | 4,7,10,13,16,19-docosahexaenoicacidethylester;stabilizedwithVitaminE,95%;ETHYL CIS-4,7,10,13,16,19-DOCOSAHEXAENOATE;CIS-4,7,10,13,16,19-DOCOSAHEXAENOIC ACID ETHYL ESTER;DHA ETHYL ESTER;cis-4,7,10,13,16,19-Docosahexaenoic acid ethyl ester (stabilized with vitamine E);cis-4,7,10,13,16,19-docosahexaenoic*acid ethyl es;CIS-4,7,10,13,16,19-DOCOSAHEXAENOICACID ETHYL ESTE | | CAS: | 84494-72-4 | | MF: | C24H36O2 | | MW: | 356.54 | | EINECS: | | | Product Categories: | Biochemistry;Higher Fatty Acids & Higher Alcohols;Unsaturated Higher Fatty Acid Esters;Ethyl EsterBiochemicals Found in Plants;Esters;Lipids;Polyunsaturated;Unsaturated fatty acids and derivatives;Ethyl Ester | | Mol File: | 84494-72-4.mol |  |
| | CIS-4,7,10,13,16,19-DOCOSAHEXAENOIC ACID ETHYL ESTER Chemical Properties |
| Boiling point | 443.5±24.0 °C(Predicted) | | density | 0.914±0.06 g/cm3(Predicted) | | refractive index | 1.4910-1.4960 | | storage temp. | −20°C | | solubility | Soluble in DMSO | | form | Liquid | | color | Colorless to Light yellow to Light orange | | biological source | algae | | InChI | InChI=1S/C24H36O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(25)26-4-2/h5-6,8-9,11-12,14-15,17-18,20-21H,3-4,7,10,13,16,19,22-23H2,1-2H3 | | InChIKey | ITNKVODZACVXDS-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)CCC=CCC=CCC=CCC=CCC=CCC=CCC |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 2916196000 | | Storage Class | 10 - Combustible liquids |
| | CIS-4,7,10,13,16,19-DOCOSAHEXAENOIC ACID ETHYL ESTER Usage And Synthesis |
| Uses | Docosahexanoic Acid Ethyl Ester is an omega-3 fatty acid found in marine fish oils and in many phospholipids. Major structural component of excitable membranes of the retina and brain; synthesized in the liver from α-linolenic acid. Nutritional supplement. | | Definition | ChEBI: Docosa-4,7,10,13,16,19-hexaenoic acid ethyl ester is a polyunsaturated fatty ester. |
| | CIS-4,7,10,13,16,19-DOCOSAHEXAENOIC ACID ETHYL ESTER Preparation Products And Raw materials |
|