|
|
| | 1-Chloro-4-fluorobenzene Basic information |
| | 1-Chloro-4-fluorobenzene Chemical Properties |
| Melting point | -21.5 °C | | Boiling point | 129-130 °C(lit.) | | density | 1.226 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.495(lit.) | | Fp | 85 °F | | storage temp. | Flammables area | | solubility | Difficult to mix. | | form | Liquid | | Specific Gravity | 1.226 | | color | Clear colorless to slightly yellow | | BRN | 1904542 | | InChI | InChI=1S/C6H4ClF/c7-5-1-3-6(8)4-2-5/h1-4H | | InChIKey | RJCGZNCCVKIBHO-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC=C(F)C=C1 | | CAS DataBase Reference | 352-33-0(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 1-chloro-4-fluoro-(352-33-0) | | EPA Substance Registry System | Benzene, 1-chloro-4-fluoro- (352-33-0) |
| | 1-Chloro-4-fluorobenzene Usage And Synthesis |
| Chemical Properties | Clear colourless to light yellow liquid | | Uses | 1-Chloro-4-fluorobenzeneis used as a primary and secondary intermediates, organic synthesis. And it is also used to prepare (4'-fluoro-biphenyl-4-yl)-methyl ether by using reagents NaH, Ni (OAc)2, 2,2 '-bipyridyl, KI and solvents benzene, tetrahydrofuran at temperature of 63°C. |
| | 1-Chloro-4-fluorobenzene Preparation Products And Raw materials |
|