| Company Name: |
BEIJINGYIWANJINGRUI Gold
|
| Tel: |
15866847540 |
| Email: |
dengyt2000@163.com |
| Products Intro: |
Product Name:(9H-Fluoren-9-yl)methyl (4-(hydroxymethyl)phenyl)carbamate
CAS:475160-83-9
Purity:95 Package:10g;100g;1000g
|
| Company Name: |
Beijing Ouhe Technology Co., Ltd
|
| Tel: |
13552068683 13522913783 |
| Email: |
2355560935@qq.com |
| Products Intro: |
Product Name:(9H-Fluoren-9-yl)methyl (4-(hydroxymethyl)phenyl)carbamate
CAS:475160-83-9
Purity:98% Package:10g;50g
|
|
| | FMOC-4-AMINOBENZYLALCOHOL Basic information |
| Product Name: | FMOC-4-AMINOBENZYLALCOHOL | | Synonyms: | FMOC-4-AMINOBENZYLALCOHOL;(9H-Fluoren-9-yl)methyl (4-(hydroxymethyl)phenyl)carbamate;9H-fluoren-9-ylmethyl N-[4-(hydroxymethyl)phenyl]carbamate;Carbamic acid, N-[4-(hydroxymethyl)phenyl]-, 9H-fluoren-9-ylmethyl ester;4-(Fmoc-amino)benzyl Alcohol;(9H-Fluoren-9-yl)methyl (4-(hydroxymethyl)phenyl)carbamate - [F90322] | | CAS: | 475160-83-9 | | MF: | C22H19NO3 | | MW: | 345.39 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | FMOC-4-AMINOBENZYLALCOHOL Chemical Properties |
| Melting point | 185 °C(Solv: toluene (108-88-3); ethyl acetate (141-78-6)) | | Boiling point | 520.4±38.0 °C(Predicted) | | density | 1.293±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 13.05±0.70(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C22H19NO3/c24-13-15-9-11-16(12-10-15)23-22(25)26-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21,24H,13-14H2,(H,23,25) | | InChIKey | AMCNVVZGRKIDRW-UHFFFAOYSA-N | | SMILES | C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)(=O)NC1=CC=C(CO)C=C1 |
| | FMOC-4-AMINOBENZYLALCOHOL Usage And Synthesis |
| | FMOC-4-AMINOBENZYLALCOHOL Preparation Products And Raw materials |
|