|
|
| | 1-[3-(trifluoromethyl)pyridin-2-yl]piperidin-4-one Basic information |
| | 1-[3-(trifluoromethyl)pyridin-2-yl]piperidin-4-one Chemical Properties |
| Boiling point | 343.7±42.0 °C(Predicted) | | density | 1.320±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 5.68±0.29(Predicted) | | form | solid | | InChI | 1S/C11H11F3N2O/c12-11(13,14)9-2-1-5-15-10(9)16-6-3-8(17)4-7-16/h1-2,5H,3-4,6-7H2 | | InChIKey | MTKRSQNGRLYWCQ-UHFFFAOYSA-N | | SMILES | FC(F)(F)C1=C(N=CC=C1)N(CC2)CCC2=O |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 1-[3-(trifluoromethyl)pyridin-2-yl]piperidin-4-one Usage And Synthesis |
| | 1-[3-(trifluoromethyl)pyridin-2-yl]piperidin-4-one Preparation Products And Raw materials |
|