|
|
| | Benzotriazole-5-carboxylic acid Basic information | | Uses |
| | Benzotriazole-5-carboxylic acid Chemical Properties |
| Melting point | 305 °C | | Boiling point | 0°C | | density | 1.617±0.06 g/cm3(Predicted) | | Fp | 0°C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | slightly sol. in Dimethylformamide | | pka | 3.47±0.30(Predicted) | | form | powder to crystal | | color | Light yellow to Brown | | InChI | InChI=1S/C7H5N3O2/c11-7(12)4-1-2-5-6(3-4)9-10-8-5/h1-3H,(H,11,12)(H,8,9,10) | | InChIKey | GUOVBFFLXKJFEE-UHFFFAOYSA-N | | SMILES | N1C2=CC(C(O)=O)=CC=C2N=N1 | | CAS DataBase Reference | 23814-12-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Hazard Note | Harmful | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Benzotriazole-5-carboxylic acid Usage And Synthesis |
| Uses | Benzotriazole-5-carboxylic acid (cas# 23814-12-2) is a useful research chemical. | | Chemical Properties | Earthy yellow powder | | Uses | Benzotriazole-5-carboxylic acid was used as bifunctional ligand in solvent induced synthesis of diverse dimensional coordination assemblies of cupric benzotriazole-5-carboxylate. It was also used in hydrothermal synthesis of new coordination polymer, [Zn(Btca)(Phen)]n (H2Btca = benzotriazole-5-carboxylic acid, Phen = 1,10-phenanthroline). |
| | Benzotriazole-5-carboxylic acid Preparation Products And Raw materials |
|