- Cyclopentene oxide
-
- $100.00 / 1KG
-
2025-09-25
- CAS:285-67-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
- Cyclopentene oxide
-
- $30.00 / 1KG
-
2025-06-27
- CAS:285-67-6
- Min. Order: 50KG
- Purity: 99%
- Supply Ability: 500000kg
- Cyclopentene oxide
-
- $25.00 / 1kg
-
2025-06-20
- CAS:285-67-6
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 10 tons
|
| | Cyclopentene oxide Basic information |
| Product Name: | Cyclopentene oxide | | Synonyms: | 1,2-epoxy-cyclopentan;1,2-Epoxycyclopentane
Cyclopentene oxide
6-Oxabicyclo[3.1.0]hexane;Cyclopentene oxide,98%;Cyclopentene oxide,1,2-Epoxycyclopentane, 6-Oxabicyclo[3.1.0]hexane;1,2-Epoxycyclopentane, Cyclopentene oxide;Cyclopentene oxide, 98% 25GR;Cyclopentene Oxide
6-Oxabicyclo[3.1.0]hexane;cyclopentene oxide radical cation | | CAS: | 285-67-6 | | MF: | C5H8O | | MW: | 84.12 | | EINECS: | 206-005-6 | | Product Categories: | Pharmaceutical intermediates;Organics | | Mol File: | 285-67-6.mol |  |
| | Cyclopentene oxide Chemical Properties |
| Melting point | 136-137 °C | | Boiling point | 102 °C(lit.) | | density | 0.964 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.434(lit.) | | Fp | 50 °F | | storage temp. | 2-8°C | | form | Liquid | | color | Clear colorless to very faintly yellow | | Water Solubility | Immiscible with water. | | BRN | 102495 | | InChI | InChI=1S/C5H8O/c1-2-4-5(3-1)6-4/h4-5H,1-3H2 | | InChIKey | GJEZBVHHZQAEDB-UHFFFAOYSA-N | | SMILES | C12C(O1)CCC2 | | LogP | 0.908 (est) | | CAS DataBase Reference | 285-67-6(CAS DataBase Reference) | | NIST Chemistry Reference | cis-1,2-Epoxycyclopentane(285-67-6) | | EPA Substance Registry System | 6-Oxabicyclo[3.1.0]hexane (285-67-6) |
| Hazard Codes | F,Xi | | Risk Statements | 11-36/37/38 | | Safety Statements | 16-26-36-36/37/39 | | RIDADR | UN 1993 3/PG 2 | | WGK Germany | 3 | | RTECS | RN8935000 | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29109000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 2
Skin Irrit. 2
STOT SE 3 | | Hazardous Substances Data | 285-67-6(Hazardous Substances Data) |
| | Cyclopentene oxide Usage And Synthesis |
| Chemical Properties | Clear colorless to very faintly yellow liquid | | Uses | Cyclopentene oxide is used to prepare beta-amino alcohols by reacting with aromatic amines using bismuth trichloride as a catalyst. |
| | Cyclopentene oxide Preparation Products And Raw materials |
| Raw materials | Dichloromethane-->3-Chloroperoxybenzoic acid-->Cyclopentene-->Benzonitrile, 4-(dimethyloxidoamino)--->4-(N-Methylamino)benzonitrile-->4-(DIMETHYLAMINO)BENZONITRILE | | Preparation Products | trans-1,2-Cyclopentanediol-->IODOCYCLOPENTANE-->TRANS-2-METHYLCYCLOPENTANOL-->Cyclopentanol, 2-[2-(trimethylsilyl)ethynyl]--->Cyclopentanol, 2-[(1-methylethyl)amino]-, trans- (9CI)-->Cyclopentanol, 2-methoxy-, (1R,2R)--->Cyclopentanol, 2-(2-propyn-1-yl)-, (1R,2R)-rel- |
|