6-BENZYLOXYPURINE manufacturers
- 6-BENZYLOXYPURINE
-
- $1.80
-
2020-03-22
- CAS:57500-07-9
- Min. Order: 1g
- Purity: 90.0%-99.9%
- Supply Ability: 800kg
|
| | 6-BENZYLOXYPURINE Basic information |
| | 6-BENZYLOXYPURINE Chemical Properties |
| Melting point | 173-175 °C (lit.) | | Boiling point | 414.9±55.0 °C(Predicted) | | density | 1.36±0.1 g/cm3(Predicted) | | pka | 8.28±0.20(Predicted) | | form | powder to crystal | | color | White to Light yellow to Green | | InChI | 1S/C12H10N4O/c1-2-4-9(5-3-1)6-17-12-10-11(14-7-13-10)15-8-16-12/h1-5,7-8H,6H2,(H,13,14,15,16) | | InChIKey | ZZZXGPGVDJDFCJ-UHFFFAOYSA-N | | SMILES | C(Oc1ncnc2[nH]cnc12)c3ccccc3 | | CAS DataBase Reference | 57500-07-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 6-BENZYLOXYPURINE Usage And Synthesis |
| Chemical Properties | White solid | | Synthesis Reference(s) | Synthetic Communications, 19, p. 1669, 1989 DOI: 10.1080/00397918908051065 |
| | 6-BENZYLOXYPURINE Preparation Products And Raw materials |
|