|
|
| | Calcium bis(2-hydroxy-4-(methylthio)butyrate) Basic information |
| | Calcium bis(2-hydroxy-4-(methylthio)butyrate) Chemical Properties |
| Melting point | >270°C (dec.) | | storage temp. | 2-8°C | | solubility | Water (Sparingly, Sonicated) | | form | Solid | | color | White to Off-White | | Merck | 14,5976 | | Stability: | Stable under recommended storage conditions., Stable Under Recommended Storage C | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChI | 1S/2C5H10O3S.Ca/c2*1-9-3-2-4(6)5(7)8;/h2*4,6H,2-3H2,1H3,(H,7,8);/q;;+2/p-2 | | InChIKey | ABRVDWASZFDIEH-UHFFFAOYSA-L | | SMILES | CSCCC(O)C(=O)O[Ca]OC(=O)C(O)CCSC | | CAS DataBase Reference | 4857-44-7(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | RTECS | ET4731600 | | F | 3-8-10 | | Storage Class | 11 - Combustible Solids | | Toxicity | LD50 oral in rat: 12870mg/kg |
| | Calcium bis(2-hydroxy-4-(methylthio)butyrate) Usage And Synthesis |
| Uses | Calcium α-Hydroxy-γ-Methylmercaptobutyrate is useful in ion pairing inside Mammals and is therefore useful when it comes to nitrogen retention allowing for animal to grow quickly. |
| | Calcium bis(2-hydroxy-4-(methylthio)butyrate) Preparation Products And Raw materials |
|