| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2-(2-fluorophenoxy)benzoic acid Basic information |
| | 2-(2-fluorophenoxy)benzoic acid Chemical Properties |
| Melting point | 140 °C(Solv: ethanol (64-17-5); water (7732-18-5)) | | Boiling point | 323.5±27.0 °C(Predicted) | | density | 1.313±0.06 g/cm3(Predicted) | | pka | 3.21±0.36(Predicted) | | form | solid | | InChI | 1S/C13H9FO3/c14-10-6-2-4-8-12(10)17-11-7-3-1-5-9(11)13(15)16/h1-8H,(H,15,16) | | InChIKey | IRDFTUPBYRSFEP-UHFFFAOYSA-N | | SMILES | FC1=CC=CC=C1OC2=CC=CC=C2C(O)=O |
| WGK Germany | WGK 3 | | HS Code | 2918999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| | 2-(2-fluorophenoxy)benzoic acid Usage And Synthesis |
| | 2-(2-fluorophenoxy)benzoic acid Preparation Products And Raw materials |
|