3-Methyl-2-(3,4-dimethoxyphenyl)butyronitrile manufacturers
|
| | 3-Methyl-2-(3,4-dimethoxyphenyl)butyronitrile Basic information |
| Product Name: | 3-Methyl-2-(3,4-dimethoxyphenyl)butyronitrile | | Synonyms: | 2-(3,4-Dimethoxyphenyl)-2-isopropylacetonitrile;BENZENEACETONITRILE,3,4-DIMETHOXY-A-(1-METHYLETHYL)-;3-METHYL-2-(3,4-DIMETHOXYPHENYL)BUTYRONITRILE;α-Isopropyl-3,4-dimethoxybenzeneacetonitrile;2-(3,4-DiMethoxy phenyl)-ó-Methylbutyronitrile;2-(3,4-DiMethoxy phenyl)-d-Methylbutyronitrile;2-(3,4-DiMethoxy phenyl)-β-Methylbutyronitrile;Verapamil Impurity K | | CAS: | 20850-49-1 | | MF: | C13H17NO2 | | MW: | 219.28 | | EINECS: | 244-082-8 | | Product Categories: | (intermediate of rerapamil hcl);Aromatics | | Mol File: | 20850-49-1.mol |  |
| | 3-Methyl-2-(3,4-dimethoxyphenyl)butyronitrile Chemical Properties |
| Melting point | 46-49°C | | Boiling point | 160-166 °C(Press: 6 Torr) | | density | 1.023±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Pale Yellow | | Major Application | pharmaceutical | | InChI | 1S/C13H17NO2/c1-9(2)11(8-14)10-5-6-12(15-3)13(7-10)16-4/h5-7,9,11H,1-4H3 | | InChIKey | NFXAXMOAVPLEBH-UHFFFAOYSA-N | | SMILES | N#CC(C(C)C)c1cc(c(cc1)OC)OC | | CAS DataBase Reference | 20850-49-1(CAS DataBase Reference) |
| WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2926907090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-Methyl-2-(3,4-dimethoxyphenyl)butyronitrile Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | (Verapamil EP Impurity K) |
| | 3-Methyl-2-(3,4-dimethoxyphenyl)butyronitrile Preparation Products And Raw materials |
|