|
|
| | 11-HYDROXYUNDECANOIC ACID Basic information |
| | 11-HYDROXYUNDECANOIC ACID Chemical Properties |
| Melting point | 65-69 °C | | Boiling point | 280.42°C (rough estimate) | | density | 1.0270 (rough estimate) | | refractive index | 1.4174 (estimate) | | storage temp. | Store at room temperature | | solubility | Chloroform, DCM, Ethyl Acetate, Methanol | | form | Solid | | pka | 4.78±0.10(Predicted) | | color | White | | InChI | InChI=1S/C11H22O3/c12-10-8-6-4-2-1-3-5-7-9-11(13)14/h12H,1-10H2,(H,13,14) | | InChIKey | KNRCBASNXNXUQQ-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCCCCCCCCO | | LogP | 2.490 (est) | | CAS DataBase Reference | 3669-80-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29181998 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 11-HYDROXYUNDECANOIC ACID Usage And Synthesis |
| Chemical Properties | WHITE POWDER AND CHUNKS | | Uses | 11-Hydroxyundecanoic acid can be prepared by employing the following starting reagents:
- 10-undecenoic acid
- undecylenic acid and hydrobromic acid
- methyl 11-bromoundecanoate
- ricinoleic acid (12-hydroxyoleic acid)
| | Definition | ChEBI: An omega-hydroxy fatty acid that is undecanoic acid in which one of the hydrogens of the terminal methyl group is replaced by a hydroxy group. | | Synthesis Reference(s) | Synthetic Communications, 19, p. 2783, 1989 DOI: 10.1080/00397918908052665 |
| | 11-HYDROXYUNDECANOIC ACID Preparation Products And Raw materials |
|